Products 41483-70-9

CAS 41483-70-9 appears in our catalog under these names: 4-Methylpiperidine-1-sulfonyl chloride, 97%, 4–Methylpiperidine–1–sulfonyl chloride, 4-Methylpiperidine-1-sulfonyl chloride 97%, 4-Methyl-piperidine-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

4-methylpiperidine-1-sulfonyl chloride (CAS 41483-70-9) is a chemical compound with the molecular formula C6H12ClNO2S and a molecular weight of 197.68 g/mol. IUPAC name: 4-methylpiperidine-1-sulfonyl chloride. InChIKey: IVVNPRFHZBOVAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2S
Molecular weight197.68 g/mol
IUPAC name4-methylpiperidine-1-sulfonyl chloride
InChIKeyIVVNPRFHZBOVAZ-UHFFFAOYSA-N
SMILESCC1CCN(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)