Products 1031498-32-4

CAS 1031498-32-4 is the registry number for Methyl 1-(1,3-benzothiazol-2-yl)piperidine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 1-(1,3-benzothiazol-2-yl)piperidine-4-carboxylate (CAS 1031498-32-4) is a chemical compound with the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. IUPAC name: methyl 1-(1,3-benzothiazol-2-yl)piperidine-4-carboxylate. InChIKey: ILNITRJPRKPIOI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O2S
Molecular weight276.36 g/mol
IUPAC namemethyl 1-(1,3-benzothiazol-2-yl)piperidine-4-carboxylate
InChIKeyILNITRJPRKPIOI-UHFFFAOYSA-N
SMILESCOC(=O)C1CCN(CC1)C2=NC3=CC=CC=C3S2

Computed by PubChem (NCBI)