Products 1031582-27-0
CAS 1031582-27-0 is the registry number for N-(Thiophen-2-ylmethyl)-1H-indole-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(thiophen-2-ylmethyl)-1H-indole-2-carboxamide (CAS 1031582-27-0) is a chemical compound with the molecular formula C14H12N2OS and a molecular weight of 256.32 g/mol. IUPAC name: N-(thiophen-2-ylmethyl)-1H-indole-2-carboxamide. InChIKey: DKEUCUIERCKIIY-UHFFFAOYSA-N.
| Molecular formula | C14H12N2OS |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | N-(thiophen-2-ylmethyl)-1H-indole-2-carboxamide |
| InChIKey | DKEUCUIERCKIIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)NCC3=CC=CS3 |
Computed by PubChem (NCBI)