CAS 17537-75-6 is the registry number for 5-(2,5-Dimethylphenyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(2,5-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 17537-75-6) is a chemical compound with the molecular formula C14H12N2OS and a molecular weight of 256.32 g/mol. IUPAC name: 5-(2,5-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: PFFIJZJZRRWJHT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2OS |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 5-(2,5-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | PFFIJZJZRRWJHT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)