CAS 566169-93-5 appears in our catalog under these names: 2–(4–(Methylamino)phenyl)benzo(d)thiazol–6–ol, PiB/ 97.02% (existing batch purity), Pittsburgh Compound-B 95%, 2-(4-(Methylamino)phenyl)benzo[d]thiazol-6-ol, 95%, 95%, Pittsburgh Compound B, 98.0%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol (CAS 566169-93-5) is a chemical compound with the molecular formula C14H12N2OS and a molecular weight of 256.32 g/mol. IUPAC name: 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol. InChIKey: ZQAQXZBSGZUUNL-UHFFFAOYSA-N.
| Molecular formula | C14H12N2OS |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol |
| InChIKey | ZQAQXZBSGZUUNL-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)O |
Computed by PubChem (NCBI)