CAS 1031619-88-1 appears in our catalog under these names: 3-Methyl-(1,2,4)triazolo(4,3-a)pyridine-6-carboxylic acid, 3-Methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1031619-88-1) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: SHYXTVRNKAUFPL-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | SHYXTVRNKAUFPL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)