CAS 103188-46-1 appears in our catalog under these names: (E)-N-(3,4-Dihydroxyphenethyl)-3-(4-hydroxyphenyl)acrylamide, 95%, (E)–N–(3,4–Dihydroxyphenethyl)–3–(4–hydroxyphenyl)acrylamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 50mg.
(E)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)prop-2-enamide (CAS 103188-46-1) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (E)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)prop-2-enamide. InChIKey: KZUJJPCTENPKOE-XBXARRHUSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (E)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| InChIKey | KZUJJPCTENPKOE-XBXARRHUSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)NCCC2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)