CAS 1031929-04-0 appears in our catalog under these names: (4-([5-(Trifluoromethyl)pyridin-2-yl]oxy)phenyl)methanol, 95%, (4-((5-(Trifluoromethyl)pyridin-2-yl)oxy)phenyl)methanol 98%, (4-((5-(Trifluoromethyl)pyridin-2-yl)oxy)phenyl)methanol, 95%, 95%, (4-{[5-(Trifluoromethyl)pyridin-2-yl]oxy}phenyl)methanol, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol (CAS 1031929-04-0) is a chemical compound with the molecular formula C13H10F3NO2 and a molecular weight of 269.22 g/mol. IUPAC name: [4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol. InChIKey: DOTLIZSCTKNOJS-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO2 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | [4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol |
| InChIKey | DOTLIZSCTKNOJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)OC2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)