Products 2771022-78-5
CAS 2771022-78-5 is the registry number for Methyl 2-(1-cyanocyclopropyl)-4-(trifluoromethyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(1-cyanocyclopropyl)-4-(trifluoromethyl)benzoate (CAS 2771022-78-5) is a chemical compound with the molecular formula C13H10F3NO2 and a molecular weight of 269.22 g/mol. IUPAC name: methyl 2-(1-cyanocyclopropyl)-4-(trifluoromethyl)benzoate. InChIKey: RLAUPKBOXJVOKU-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO2 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | methyl 2-(1-cyanocyclopropyl)-4-(trifluoromethyl)benzoate |
| InChIKey | RLAUPKBOXJVOKU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)C2(CC2)C#N |
Computed by PubChem (NCBI)