CAS 363-21-3 appears in our catalog under these names: 2,2,2-Trifluoroethyl 1-naphthylcarbamate, 95%, 2,2,2-Trifluoroethyl naphthalen-1-ylcarbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,2,2-trifluoroethyl N-naphthalen-1-ylcarbamate (CAS 363-21-3) is a chemical compound with the molecular formula C13H10F3NO2 and a molecular weight of 269.22 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-naphthalen-1-ylcarbamate. InChIKey: PMOZNNRVDHIFKO-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO2 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-naphthalen-1-ylcarbamate |
| InChIKey | PMOZNNRVDHIFKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)