CAS 1032038-96-2 appears in our catalog under these names: N-tert-Butyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide, 95%, N-tert-Butyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-tert-butyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CAS 1032038-96-2) is a chemical compound with the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. IUPAC name: N-tert-butyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. InChIKey: ZVUFXVOWXLBOGH-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O2S |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | N-tert-butyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| InChIKey | ZVUFXVOWXLBOGH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)NC(C)(C)C |
Computed by PubChem (NCBI)