Products 944416-16-4
CAS 944416-16-4 appears in our catalog under these names: N,N-Diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide, 95%, N,N-Diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CAS 944416-16-4) is a chemical compound with the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. IUPAC name: N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. InChIKey: JYZSUIPYLDDJDC-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O2S |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | N,N-diethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| InChIKey | JYZSUIPYLDDJDC-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(NN=C1C)C |
Computed by PubChem (NCBI)