Products 1251037-85-0
CAS 1251037-85-0 is the registry number for 3,5-Dimethyl-1-(2-methylpropyl)-1H-pyrazole-4-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide (CAS 1251037-85-0) is a chemical compound with the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. IUPAC name: 3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide. InChIKey: FBBBZMMEXIGBNS-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O2S |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonamide |
| InChIKey | FBBBZMMEXIGBNS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(C)C)C)S(=O)(=O)N |
Computed by PubChem (NCBI)