CAS 103204-80-4 is the registry number for 2-Methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid (CAS 103204-80-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid. InChIKey: NXNQXQFRCVUXIN-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-methyl-2,3-dihydro-1-benzofuran-5-carboxylic acid |
| InChIKey | NXNQXQFRCVUXIN-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(O1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)