Products 1032156-97-0
CAS 1032156-97-0 appears in our catalog under these names: (R)-1-(4-ethylphenyl)propan-1-amine hydrochloride, 96%, 96%, (R)-1-(4-ethylphenyl)propan-1-amine hydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-ethylphenyl)propan-1-amine;hydrochloride (CAS 1032156-97-0) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-1-(4-ethylphenyl)propan-1-amine;hydrochloride. InChIKey: OSNYCBVXSXZCKP-RFVHGSKJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-1-(4-ethylphenyl)propan-1-amine;hydrochloride |
| InChIKey | OSNYCBVXSXZCKP-RFVHGSKJSA-N |
| SMILES | CCC1=CC=C(C=C1)[C@@H](CC)N.Cl |
Computed by PubChem (NCBI)