Products 1032334-56-7

CAS 1032334-56-7 appears in our catalog under these names: 3-Amino-1h-pyrazole-5-carboxylic acid hydrochloride, 95%, 3-Amino-1H-pyrazole-5-carboxylic acid hydrochloride, 97%, 3-Amino-1H-pyrazole-5-carboxylic acid hydrochloride, 5-Amino-2 H -pyrazole-3-carboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g, 0,25g.

Structural formula: {0} (CAS {1})

3-amino-1H-pyrazole-5-carboxylic acid;hydrochloride (CAS 1032334-56-7) is a chemical compound with the molecular formula C4H6ClN3O2 and a molecular weight of 163.56 g/mol. IUPAC name: 3-amino-1H-pyrazole-5-carboxylic acid;hydrochloride. InChIKey: WFTUQBROQVCLGE-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClN3O2
Molecular weight163.56 g/mol
IUPAC name3-amino-1H-pyrazole-5-carboxylic acid;hydrochloride
InChIKeyWFTUQBROQVCLGE-UHFFFAOYSA-N
SMILESC1=C(NN=C1N)C(=O)O.Cl

Computed by PubChem (NCBI)