Products 1445951-85-8

CAS 1445951-85-8 is the registry number for 5-Methyl-2h-1,2,3-triazole-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-methyl-2H-triazole-4-carboxylic acid;hydrochloride (CAS 1445951-85-8) is a chemical compound with the molecular formula C4H6ClN3O2 and a molecular weight of 163.56 g/mol. IUPAC name: 5-methyl-2H-triazole-4-carboxylic acid;hydrochloride. InChIKey: NTTLOCJSSSEPGL-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClN3O2
Molecular weight163.56 g/mol
IUPAC name5-methyl-2H-triazole-4-carboxylic acid;hydrochloride
InChIKeyNTTLOCJSSSEPGL-UHFFFAOYSA-N
SMILESCC1=NNN=C1C(=O)O.Cl

Computed by PubChem (NCBI)