CAS 1881320-90-6 is the registry number for 1-methyl-4-nitro-1H-pyrazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-methyl-4-nitropyrazole;hydrochloride (CAS 1881320-90-6) is a chemical compound with the molecular formula C4H6ClN3O2 and a molecular weight of 163.56 g/mol. IUPAC name: 1-methyl-4-nitropyrazole;hydrochloride. InChIKey: FBHHNDUJOFYVRL-UHFFFAOYSA-N.
| Molecular formula | C4H6ClN3O2 |
|---|---|
| Molecular weight | 163.56 g/mol |
| IUPAC name | 1-methyl-4-nitropyrazole;hydrochloride |
| InChIKey | FBHHNDUJOFYVRL-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)