CAS 1032825-28-7 appears in our catalog under these names: [4-[[[2-(Methoxy)ethyl]amino]sulfonyl]phenyl]boronic acid, 95%, (4-(N-(2-Methoxyethyl)sulfamoyl)phenyl)boronic acid, 98%, B–(4–(((2–methoxyethyl)amino)sulfonyl)phenyl)Boronic acid, Boronic acid, B-[4-[[(2-methoxyethyl)amino]sulfonyl]phenyl]-, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[4-(2-methoxyethylsulfamoyl)phenyl]boronic acid (CAS 1032825-28-7) is a chemical compound with the molecular formula C9H14BNO5S and a molecular weight of 259.09 g/mol. IUPAC name: [4-(2-methoxyethylsulfamoyl)phenyl]boronic acid. InChIKey: PNNBBUKGGKVDKY-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO5S |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | [4-(2-methoxyethylsulfamoyl)phenyl]boronic acid |
| InChIKey | PNNBBUKGGKVDKY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCOC)(O)O |
Computed by PubChem (NCBI)