CAS 1704069-09-9 is the registry number for (4–(N–Methoxysulfamoyl)–3,5–dimethylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-(methoxysulfamoyl)-3,5-dimethylphenyl]boronic acid (CAS 1704069-09-9) is a chemical compound with the molecular formula C9H14BNO5S and a molecular weight of 259.09 g/mol. IUPAC name: [4-(methoxysulfamoyl)-3,5-dimethylphenyl]boronic acid. InChIKey: QNNARTGXCBIVRK-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO5S |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | [4-(methoxysulfamoyl)-3,5-dimethylphenyl]boronic acid |
| InChIKey | QNNARTGXCBIVRK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)NOC)C)(O)O |
Computed by PubChem (NCBI)