CAS 859160-65-9 is the registry number for (5–(N,N–Dimethylsulfamoyl)–2–methoxyphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[5-(dimethylsulfamoyl)-2-methoxyphenyl]boronic acid (CAS 859160-65-9) is a chemical compound with the molecular formula C9H14BNO5S and a molecular weight of 259.09 g/mol. IUPAC name: [5-(dimethylsulfamoyl)-2-methoxyphenyl]boronic acid. InChIKey: ZXOICVGQXNCOTK-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO5S |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | [5-(dimethylsulfamoyl)-2-methoxyphenyl]boronic acid |
| InChIKey | ZXOICVGQXNCOTK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N(C)C)OC)(O)O |
Computed by PubChem (NCBI)