Products 1032998-24-5
CAS 1032998-24-5 appears in our catalog under these names: N-Acetyl-D-(2-¹³C)neuraminic acid, N-Acetylneuraminic acid-13C-1. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg, 1mg, 5mg.
(4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxo(213C)nonanoic acid (CAS 1032998-24-5) is a chemical compound with the molecular formula C11H19NO9 and a molecular weight of 310.26 g/mol. IUPAC name: (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxo(213C)nonanoic acid. InChIKey: KBGAYAKRZNYFFG-MFOUSPHQSA-N.
| Molecular formula | C11H19NO9 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxo(213C)nonanoic acid |
| InChIKey | KBGAYAKRZNYFFG-MFOUSPHQSA-N |
| SMILES | CC(=O)N[C@H]([C@H](C[13C](=O)C(=O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
N-Acetylneuraminic acid-13C-1