CAS 17671-50-0 appears in our catalog under these names: Betaine citrate, 95%, 2-(Trimethylammonio)acetate 2-hydroxypropane-1,2,3-tricarboxylic acid salt 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100g, 500g, 25g, 5g, 1000g.
2-hydroxypropane-1,2,3-tricarboxylic acid;2-(trimethylazaniumyl)acetate (CAS 17671-50-0) is a chemical compound with the molecular formula C11H19NO9 and a molecular weight of 309.27 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylic acid;2-(trimethylazaniumyl)acetate. InChIKey: YKXUOESQDCXGIW-UHFFFAOYSA-N.
| Molecular formula | C11H19NO9 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2-(trimethylazaniumyl)acetate |
| InChIKey | YKXUOESQDCXGIW-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(=O)[O-].C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)