Products 64162-77-2
CAS 64162-77-2 is the registry number for N-Acetylneuraminic acid-13C. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg.
(4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxo(113C)nonanoic acid (CAS 64162-77-2) is a chemical compound with the molecular formula C11H19NO9 and a molecular weight of 310.26 g/mol. IUPAC name: (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxo(113C)nonanoic acid. InChIKey: KBGAYAKRZNYFFG-VJHVGEQBSA-N.
| Molecular formula | C11H19NO9 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentahydroxy-2-oxo(113C)nonanoic acid |
| InChIKey | KBGAYAKRZNYFFG-VJHVGEQBSA-N |
| SMILES | CC(=O)N[C@H]([C@H](CC(=O)[13C](=O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
N-Acetylneuraminic acid-13C, orb3138470