CAS 103321-59-1 is the registry number for Fmoc-Leu-Cl, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]carbamate (CAS 103321-59-1) is a chemical compound with the molecular formula C21H22ClNO3 and a molecular weight of 371.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]carbamate. InChIKey: IAWFVICGSTUKMS-IBGZPJMESA-N.
| Molecular formula | C21H22ClNO3 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | IAWFVICGSTUKMS-IBGZPJMESA-N |
| SMILES | CC(C)C[C@@H](C(=O)Cl)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)