Products 1374509-57-5
CAS 1374509-57-5 is the registry number for Ethyl [4-(4-chlorophenyl)-2,4-dimethyl-3,4-dihydroquinolin-1(2h)-yl](oxo)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-[4-(4-chlorophenyl)-2,4-dimethyl-2,3-dihydroquinolin-1-yl]-2-oxoacetate (CAS 1374509-57-5) is a chemical compound with the molecular formula C21H22ClNO3 and a molecular weight of 371.9 g/mol. IUPAC name: ethyl 2-[4-(4-chlorophenyl)-2,4-dimethyl-2,3-dihydroquinolin-1-yl]-2-oxoacetate. InChIKey: YERXPQIIAPFWCY-UHFFFAOYSA-N.
| Molecular formula | C21H22ClNO3 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | ethyl 2-[4-(4-chlorophenyl)-2,4-dimethyl-2,3-dihydroquinolin-1-yl]-2-oxoacetate |
| InChIKey | YERXPQIIAPFWCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)N1C(CC(C2=CC=CC=C21)(C)C3=CC=C(C=C3)Cl)C |
Computed by PubChem (NCBI)