CAS 99754-06-0 appears in our catalog under these names: Ono-rs-082, 95%, ONO–RS–082, ONO-RS-082/ 99.32% (existing batch purity), ONO-RS-082, 98% , ONO-RRS 082 95%. Offered by: Combi-blocks, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 100mg, 25mg, 1mg, 2mg, 5mg, 10mg, 50mg, 20mg.
4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid (CAS 99754-06-0) is a chemical compound with the molecular formula C21H22ClNO3 and a molecular weight of 371.9 g/mol. IUPAC name: 4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid. InChIKey: MDVFITMPFHDRBZ-JLHYYAGUSA-N.
| Molecular formula | C21H22ClNO3 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid |
| InChIKey | MDVFITMPFHDRBZ-JLHYYAGUSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)/C=C/C(=O)NC2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)