Products 1033600-07-5

CAS 1033600-07-5 is the registry number for 2-(1-(2,3-Difluorobenzyl)-3-oxopiperazin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid (CAS 1033600-07-5) is a chemical compound with the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. IUPAC name: 2-[1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid. InChIKey: WPKVALCKNGRKBE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14F2N2O3
Molecular weight284.26 g/mol
IUPAC name2-[1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid
InChIKeyWPKVALCKNGRKBE-UHFFFAOYSA-N
SMILESC1CN(C(C(=O)N1)CC(=O)O)CC2=C(C(=CC=C2)F)F

Computed by PubChem (NCBI)