CAS 923207-45-8 appears in our catalog under these names: 1-((2,4-Difluorophenyl)carbamoyl)piperidine-3-carboxylic acid, 95%, 95%, 1-((2,4-Difluorophenyl)carbamoyl)piperidine-3-carboxylic acid, 98%, 1-((2,4-Difluorophenyl)carbamoyl)piperidine-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[(2,4-difluorophenyl)carbamoyl]piperidine-3-carboxylic acid (CAS 923207-45-8) is a chemical compound with the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. IUPAC name: 1-[(2,4-difluorophenyl)carbamoyl]piperidine-3-carboxylic acid. InChIKey: WCQLXRAKIDQDJX-UHFFFAOYSA-N.
| Molecular formula | C13H14F2N2O3 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 1-[(2,4-difluorophenyl)carbamoyl]piperidine-3-carboxylic acid |
| InChIKey | WCQLXRAKIDQDJX-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)NC2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)