CAS 1033600-31-5 is the registry number for 2-(1-(3,4-Difluorobenzyl)-3-oxopiperazin-2-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-[(3,4-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid (CAS 1033600-31-5) is a chemical compound with the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. IUPAC name: 2-[1-[(3,4-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid. InChIKey: GHDGMVQYDHCGOI-UHFFFAOYSA-N.
| Molecular formula | C13H14F2N2O3 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 2-[1-[(3,4-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
| InChIKey | GHDGMVQYDHCGOI-UHFFFAOYSA-N |
| SMILES | C1CN(C(C(=O)N1)CC(=O)O)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)