CAS 1033756-97-6 appears in our catalog under these names: Rel-(1S,2R)-2-aminocycloheptane-1-carboxylic acid hydrochloride, 98%, cis-2-Aminocycloheptane-COOH*HCl, rac-(1R,2S)-2-Aminocycloheptane-1-carboxylic acid hydrochloride. Offered by: AmBeed, Iris Biotech, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,1g, 0,05g, 0,25g, 0,5g.
Cis-(1S,2R)-2-aminocycloheptane-1-carboxylic acid;hydrochloride (CAS 1033756-97-6) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-(1S,2R)-2-aminocycloheptane-1-carboxylic acid;hydrochloride. InChIKey: KCRZBDJVYOBHIP-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocycloheptane-1-carboxylic acid;hydrochloride |
| InChIKey | KCRZBDJVYOBHIP-UOERWJHTSA-N |
| SMILES | C1CC[C@@H]([C@@H](CC1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)