CAS 103408-15-7 is the registry number for 1–Cyano–2–Iodonaphthalene. Offered by: GLPBio. Available pack sizes: 100mg.
2-iodonaphthalene-1-carbonitrile (CAS 103408-15-7) is a chemical compound with the molecular formula C11H6IN and a molecular weight of 279.08 g/mol. IUPAC name: 2-iodonaphthalene-1-carbonitrile. InChIKey: SWHPIWBSWYNFHB-UHFFFAOYSA-N.
| Molecular formula | C11H6IN |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 2-iodonaphthalene-1-carbonitrile |
| InChIKey | SWHPIWBSWYNFHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C#N)I |
Computed by PubChem (NCBI)