CAS 1261468-33-0 appears in our catalog under these names: 3-Iodo-2-naphthonitrile, 98%, 3-Iodo-2-naphthonitrile 98%, 3-Iodo-2-naphthonitrile, 98%, 98%, 3-Iodo-2-naphthonitrile, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 2.5g.
3-iodonaphthalene-2-carbonitrile (CAS 1261468-33-0) is a chemical compound with the molecular formula C11H6IN and a molecular weight of 279.08 g/mol. IUPAC name: 3-iodonaphthalene-2-carbonitrile. InChIKey: KSMYCLHGVJNQPS-UHFFFAOYSA-N.
| Molecular formula | C11H6IN |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 3-iodonaphthalene-2-carbonitrile |
| InChIKey | KSMYCLHGVJNQPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C#N)I |
Computed by PubChem (NCBI)