CAS 1261562-51-9 appears in our catalog under these names: 1-Iodo-2-naphthonitrile, 97%, 1-Iodonaphthalene-2-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-iodonaphthalene-2-carbonitrile (CAS 1261562-51-9) is a chemical compound with the molecular formula C11H6IN and a molecular weight of 279.08 g/mol. IUPAC name: 1-iodonaphthalene-2-carbonitrile. InChIKey: ZZUXSFPDEOPEDQ-UHFFFAOYSA-N.
| Molecular formula | C11H6IN |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 1-iodonaphthalene-2-carbonitrile |
| InChIKey | ZZUXSFPDEOPEDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2I)C#N |
Computed by PubChem (NCBI)