Products 1034142-07-8
CAS 1034142-07-8 appears in our catalog under these names: 5-Amino-1-(3,5-difluorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 5-Amino-1-(3,5-difluorophenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-amino-1-(3,5-difluorophenyl)pyrazole-4-carboxylic acid (CAS 1034142-07-8) is a chemical compound with the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. IUPAC name: 5-amino-1-(3,5-difluorophenyl)pyrazole-4-carboxylic acid. InChIKey: ABPQWSILBFSRMP-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O2 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 5-amino-1-(3,5-difluorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | ABPQWSILBFSRMP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)N2C(=C(C=N2)C(=O)O)N |
Computed by PubChem (NCBI)