CAS 1996875-29-6 is the registry number for 1-(2, 3-Difluorobenzyl)-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[(2,3-difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid (CAS 1996875-29-6) is a chemical compound with the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. IUPAC name: 1-[(2,3-difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid. InChIKey: CFNLYVBWNHLIIE-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N3O2 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 1-[(2,3-difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid |
| InChIKey | CFNLYVBWNHLIIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CN2C=NC(=N2)C(=O)O |
Computed by PubChem (NCBI)