Products 2025179-14-8

CAS 2025179-14-8 is the registry number for 1-[(3,4-Difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(3,4-difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid (CAS 2025179-14-8) is a chemical compound with the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid. InChIKey: YTMNGVYTBAMBPN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F2N3O2
Molecular weight239.18 g/mol
IUPAC name1-[(3,4-difluorophenyl)methyl]-1,2,4-triazole-3-carboxylic acid
InChIKeyYTMNGVYTBAMBPN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CN2C=NC(=N2)C(=O)O)F)F

Computed by PubChem (NCBI)