CAS 103425-23-6 is the registry number for Alpinenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2R,3R,6S,7R)-1-hydroxy-3,7-dimethyl-10-propan-2-yl-11-oxatricyclo[5.3.1.02,6]undec-9-en-8-one (CAS 103425-23-6) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: (1S,2R,3R,6S,7R)-1-hydroxy-3,7-dimethyl-10-propan-2-yl-11-oxatricyclo[5.3.1.02,6]undec-9-en-8-one. InChIKey: CCOZSCMQQGPBEO-QFWNWRTJSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | (1S,2R,3R,6S,7R)-1-hydroxy-3,7-dimethyl-10-propan-2-yl-11-oxatricyclo[5.3.1.02,6]undec-9-en-8-one |
| InChIKey | CCOZSCMQQGPBEO-QFWNWRTJSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1[C@]3(C(=CC(=O)[C@@]2(O3)C)C(C)C)O |
Computed by PubChem (NCBI)