Products 1034497-93-2
CAS 1034497-93-2 is the registry number for tert-Butyl 3-(4-amino-2-fluorophenyl)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 3-(4-amino-2-fluorophenyl)pyrrolidine-1-carboxylate (CAS 1034497-93-2) is a chemical compound with the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. IUPAC name: tert-butyl 3-(4-amino-2-fluorophenyl)pyrrolidine-1-carboxylate. InChIKey: AKCFUVAWGKJGIM-UHFFFAOYSA-N.
| Molecular formula | C15H21FN2O2 |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | tert-butyl 3-(4-amino-2-fluorophenyl)pyrrolidine-1-carboxylate |
| InChIKey | AKCFUVAWGKJGIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)