CAS 1218764-01-2 is the registry number for Rel-tert-butyl (3R,4S)-3-amino-4-(4-fluorophenyl)pyrrolidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-3-amino-4-(4-fluorophenyl)pyrrolidine-1-carboxylate (CAS 1218764-01-2) is a chemical compound with the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. IUPAC name: tert-butyl (3R,4S)-3-amino-4-(4-fluorophenyl)pyrrolidine-1-carboxylate. InChIKey: IEDYIVQVXJQGQC-OLZOCXBDSA-N.
| Molecular formula | C15H21FN2O2 |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-amino-4-(4-fluorophenyl)pyrrolidine-1-carboxylate |
| InChIKey | IEDYIVQVXJQGQC-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)