CAS 808733-20-2 is the registry number for Rel-4-methylbenzyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-methylphenyl)methyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate (CAS 808733-20-2) is a chemical compound with the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. IUPAC name: (4-methylphenyl)methyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate. InChIKey: COWPAITVMXHKRU-KBPBESRZSA-N.
| Molecular formula | C15H21FN2O2 |
|---|---|
| Molecular weight | 280.34 g/mol |
| IUPAC name | (4-methylphenyl)methyl (3R,4S)-4-(aminomethyl)-3-fluoropiperidine-1-carboxylate |
| InChIKey | COWPAITVMXHKRU-KBPBESRZSA-N |
| SMILES | CC1=CC=C(C=C1)COC(=O)N2CC[C@H]([C@H](C2)F)CN |
Computed by PubChem (NCBI)