CAS 1034651-23-4 appears in our catalog under these names: Erlotinib-d6, Erlotinib D6, Erlotinib-d6, 99.84%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 5 mg, 1 mg.
N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine (CAS 1034651-23-4) is a chemical compound with the molecular formula C22H23N3O4 and a molecular weight of 399.5 g/mol. IUPAC name: N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine. InChIKey: AAKJLRGGTJKAMG-XERRXZQWSA-N.
| Molecular formula | C22H23N3O4 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine |
| InChIKey | AAKJLRGGTJKAMG-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC([2H])([2H])[2H] |
Computed by PubChem (NCBI)