Products 1130852-41-3
CAS 1130852-41-3 is the registry number for Erlotinib-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,7-bis(2-methoxyethoxy)-N-(2,3,4,6-tetradeuterio-5-ethynylphenyl)quinazolin-4-amine (CAS 1130852-41-3) is a chemical compound with the molecular formula C22H23N3O4 and a molecular weight of 397.5 g/mol. IUPAC name: 6,7-bis(2-methoxyethoxy)-N-(2,3,4,6-tetradeuterio-5-ethynylphenyl)quinazolin-4-amine. InChIKey: AAKJLRGGTJKAMG-HPGZLSOESA-N.
| Molecular formula | C22H23N3O4 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 6,7-bis(2-methoxyethoxy)-N-(2,3,4,6-tetradeuterio-5-ethynylphenyl)quinazolin-4-amine |
| InChIKey | AAKJLRGGTJKAMG-HPGZLSOESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])NC2=NC=NC3=CC(=C(C=C32)OCCOC)OCCOC)[2H])C#C)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Erlotinib D4