Products 19240-41-6
CAS 19240-41-6 appears in our catalog under these names: Ac–Phe–Trp–OH, Ac-Phe-Trp-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 1000mg, 5000mg.
(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (CAS 19240-41-6) is a chemical compound with the molecular formula C22H23N3O4 and a molecular weight of 393.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: IFQOQFHEONRKLI-PMACEKPBSA-N.
| Molecular formula | C22H23N3O4 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | IFQOQFHEONRKLI-PMACEKPBSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Ac-Phe-Trp-OH, Acetyl-L-phenylalanyl-L-tryptophan