Products 103494-98-0
CAS 103494-98-0 is the registry number for 7,8,9,10-Tetrahydro-benzo(f)quinazoline-1,3(2H,4H)-dione. Offered by: TRC. Available pack sizes: 1g.
7,8,9,10-tetrahydro-4H-benzo[f]quinazoline-1,3-dione (CAS 103494-98-0) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 7,8,9,10-tetrahydro-4H-benzo[f]quinazoline-1,3-dione. InChIKey: LRYCUGQJRSYEHA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 7,8,9,10-tetrahydro-4H-benzo[f]quinazoline-1,3-dione |
| InChIKey | LRYCUGQJRSYEHA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC3=C2C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)