CAS 103505-49-3 appears in our catalog under these names: 4–(4–Chlorophenyl)amino–5–amino–6–chloropyrimidine, 6-Chloro-N4-(4-chlorophenyl)pyrimidine-4,5-diamine, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 500mg.
6-chloro-4-N-(4-chlorophenyl)pyrimidine-4,5-diamine (CAS 103505-49-3) is a chemical compound with the molecular formula C10H8Cl2N4 and a molecular weight of 255.10 g/mol. IUPAC name: 6-chloro-4-N-(4-chlorophenyl)pyrimidine-4,5-diamine. InChIKey: SBVWMYQOOUEPCH-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4 |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 6-chloro-4-N-(4-chlorophenyl)pyrimidine-4,5-diamine |
| InChIKey | SBVWMYQOOUEPCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=C(C(=NC=N2)Cl)N)Cl |
Computed by PubChem (NCBI)