CAS 30369-82-5 is the registry number for N-Benzyl-4,6-dichloro-1,3,5-triazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
N-benzyl-4,6-dichloro-1,3,5-triazin-2-amine (CAS 30369-82-5) is a chemical compound with the molecular formula C10H8Cl2N4 and a molecular weight of 255.10 g/mol. IUPAC name: N-benzyl-4,6-dichloro-1,3,5-triazin-2-amine. InChIKey: QFEAITOMWXXDME-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4 |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | N-benzyl-4,6-dichloro-1,3,5-triazin-2-amine |
| InChIKey | QFEAITOMWXXDME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)