CAS 2044268-95-1 is the registry number for 9-(Bicyclo[1.1.1]pentan-1-yl)-2,6-dichloro-9H-purine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-(1-bicyclo[1.1.1]pentanyl)-2,6-dichloropurine (CAS 2044268-95-1) is a chemical compound with the molecular formula C10H8Cl2N4 and a molecular weight of 255.10 g/mol. IUPAC name: 9-(1-bicyclo[1.1.1]pentanyl)-2,6-dichloropurine. InChIKey: TXGTYLLMZREUGR-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4 |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 9-(1-bicyclo[1.1.1]pentanyl)-2,6-dichloropurine |
| InChIKey | TXGTYLLMZREUGR-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C2)N3C=NC4=C3N=C(N=C4Cl)Cl |
Computed by PubChem (NCBI)