CAS 1035219-79-4 is the registry number for 3-(2-Bromothiazol-4-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoic acid (CAS 1035219-79-4) is a chemical compound with the molecular formula C6H4BrNO2S and a molecular weight of 234.07 g/mol. IUPAC name: (E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoic acid. InChIKey: WPAPCBRWSRKUNF-OWOJBTEDSA-N.
| Molecular formula | C6H4BrNO2S |
|---|---|
| Molecular weight | 234.07 g/mol |
| IUPAC name | (E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoic acid |
| InChIKey | WPAPCBRWSRKUNF-OWOJBTEDSA-N |
| SMILES | C1=C(N=C(S1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)