Products 1035219-79-4

CAS 1035219-79-4 is the registry number for 3-(2-Bromothiazol-4-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoic acid (CAS 1035219-79-4) is a chemical compound with the molecular formula C6H4BrNO2S and a molecular weight of 234.07 g/mol. IUPAC name: (E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoic acid. InChIKey: WPAPCBRWSRKUNF-OWOJBTEDSA-N.

Identity
Molecular formulaC6H4BrNO2S
Molecular weight234.07 g/mol
IUPAC name(E)-3-(2-bromo-1,3-thiazol-4-yl)prop-2-enoic acid
InChIKeyWPAPCBRWSRKUNF-OWOJBTEDSA-N
SMILESC1=C(N=C(S1)Br)/C=C/C(=O)O

Computed by PubChem (NCBI)