CAS 853308-07-3 appears in our catalog under these names: 4-Bromo-3-nitrobenzenethiol, 95%, 4-Bromo-3-nitrobenzenethiol 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g.
4-bromo-3-nitrobenzenethiol (CAS 853308-07-3) is a chemical compound with the molecular formula C6H4BrNO2S and a molecular weight of 234.07 g/mol. IUPAC name: 4-bromo-3-nitrobenzenethiol. InChIKey: ISRPRXLDLXKKDM-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO2S |
|---|---|
| Molecular weight | 234.07 g/mol |
| IUPAC name | 4-bromo-3-nitrobenzenethiol |
| InChIKey | ISRPRXLDLXKKDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)